cas: 137391-68-5 — see every product listed under this CAS number, including other names
(3S,4R)-3-[(1R)-1-Hydroxyethyl]-4-[(1R)-1-methyl-3-diazo-3-(p-nitrobenzyloxyc... (CAS 137391-68-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2g, 5g. Offered by: Roth.
| brand | Roth |
|---|---|
| catalog number | ROTH-28YP.2 |
| cas | 137391-68-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Roth | 500mg | 920.33 Pln | |
| Roth | 1g | 1363.97 Pln | |
| Roth | 2g | 1817.05 Pln | |
| Roth | 5g | 2713.78 Pln |
| delivery time | 2 week |
|---|
(4-nitrophenyl)methyl (4R)-2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate (CAS 137391-68-5) is a chemical compound with the molecular formula C17H18N4O7 and a molecular weight of 390.3 g/mol. IUPAC name: (4-nitrophenyl)methyl (4R)-2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate. InChIKey: FDXUXRZSNNSUGD-NRMKKVEVSA-N.
| Molecular formula | C17H18N4O7 |
|---|---|
| Molecular weight | 390.3 g/mol |
| IUPAC name | (4-nitrophenyl)methyl (4R)-2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| InChIKey | FDXUXRZSNNSUGD-NRMKKVEVSA-N |
| SMILES | C[C@H]([C@@H]1[C@H](NC1=O)[C@@H](C)C(=O)C(=[N+]=[N-])C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)