cas: 1290191-73-9 — see every product listed under this CAS number, including other names
(3S,4R)-tert-Butyl 3-amino-4-fluoropiperidine-1-carboxylate, 97%, 97% (CAS 1290191-73-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YSD-10g |
| cas | 1290191-73-9 |
| size | 10g |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 7437.20 Pln | |
| Chemat | 25g | 14819.60 Pln | |
| Chemat | 50g | 25898.00 Pln | |
| Chemat | 50mg | 438.80 Pln | |
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 500mg | 1576.40 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6266.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4R)-3-amino-4-fluoropiperidine-1-carboxylate (CAS 1290191-73-9) is a chemical compound with the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-fluoropiperidine-1-carboxylate. InChIKey: CVHJEFDRBTZVEL-SFYZADRCSA-N.
| Molecular formula | C10H19FN2O2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-fluoropiperidine-1-carboxylate |
| InChIKey | CVHJEFDRBTZVEL-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)N)F |
Computed by PubChem (NCBI)