cas: 1174020-40-6 — see every product listed under this CAS number, including other names
(3S,4R)-tert-Butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate, 98%, 98% (CAS 1174020-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E9H-100mg |
| cas | 1174020-40-6 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1163.60 Pln | |
| Chemat | 50g | 2128.40 Pln | |
| Chemat | 250g | 7067.60 Pln | |
| Chemat | 500g | 13416.00 Pln | |
| Chemat | 1kg | 25278.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate (CAS 1174020-40-6) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: XRNLYXKYODGLMI-JGVFFNPUSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | XRNLYXKYODGLMI-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)O |
Computed by PubChem (NCBI)