cas: 907544-20-1 — see every product listed under this CAS number, including other names
(3S,4R)-tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate, 97%+, 97%+ (CAS 907544-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IG0Z-100mg |
| cas | 907544-20-1 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 10g | 717.20 Pln | |
| Chemat | 25g | 1648.40 Pln | |
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 250g | 13346.00 Pln | |
| Chemat | 500g | 23755.20 Pln | |
| Chemat | 100g | 5574.80 Pln |
| purity | 97%+ |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4R)-4-amino-3-fluoropiperidine-1-carboxylate (CAS 907544-20-1) is a chemical compound with the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. IUPAC name: tert-butyl (3S,4R)-4-amino-3-fluoropiperidine-1-carboxylate. InChIKey: ZQRYPCAUVKVMLZ-JGVFFNPUSA-N.
| Molecular formula | C10H19FN2O2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | tert-butyl (3S,4R)-4-amino-3-fluoropiperidine-1-carboxylate |
| InChIKey | ZQRYPCAUVKVMLZ-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)N |
Computed by PubChem (NCBI)