cas: 1171125-92-0 — see every product listed under this CAS number, including other names
(3S,4R)-tert-Butyl 4-amino-3-methoxypiperidine-1-carboxylate, 95%, 95% (CAS 1171125-92-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111DR9-100mg |
| cas | 1171125-92-0 |
| size | 100mg |
| availability | 90g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2709.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4R)-4-amino-3-methoxypiperidine-1-carboxylate (CAS 1171125-92-0) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3S,4R)-4-amino-3-methoxypiperidine-1-carboxylate. InChIKey: QNGHCFVWYKWWMU-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3S,4R)-4-amino-3-methoxypiperidine-1-carboxylate |
| InChIKey | QNGHCFVWYKWWMU-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)OC)N |
Computed by PubChem (NCBI)