cas: 1152112-99-6 — see every product listed under this CAS number, including other names
(3S,5S)-3,5-Dimethylpiperazin-2-one, 97%, 97% (CAS 1152112-99-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILD5-50mg |
| cas | 1152112-99-6 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 1000.40 Pln | |
| Chemat | 1g | 2498.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S,5S)-3,5-dimethylpiperazin-2-one (CAS 1152112-99-6) is a chemical compound with the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. IUPAC name: (3S,5S)-3,5-dimethylpiperazin-2-one. InChIKey: URZBIOXYNMRLJS-WHFBIAKZSA-N.
| Molecular formula | C6H12N2O |
|---|---|
| Molecular weight | 128.17 g/mol |
| IUPAC name | (3S,5S)-3,5-dimethylpiperazin-2-one |
| InChIKey | URZBIOXYNMRLJS-WHFBIAKZSA-N |
| SMILES | C[C@H]1CNC(=O)[C@@H](N1)C |
Computed by PubChem (NCBI)