cas: 2825-82-3 — see every product listed under this CAS number, including other names
(3aR,4S,7R,7aS)-rel-Octahydro-1H-4,7-methanoindene, 94%, 94% (CAS 2825-82-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BQS-5g |
| cas | 2825-82-3 |
| size | 5g |
| availability | 334g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 222.80 Pln |
| purity | 94% |
|---|---|
| delivery time | 3 weeks |
(1S,2R,6S,7R)-tricyclo[5.2.1.02,6]decane (CAS 2825-82-3) is a chemical compound with the molecular formula C10H16 and a molecular weight of 136.23 g/mol. IUPAC name: (1S,2R,6S,7R)-tricyclo[5.2.1.02,6]decane. InChIKey: LPSXSORODABQKT-FIRGSJFUSA-N.
| Molecular formula | C10H16 |
|---|---|
| Molecular weight | 136.23 g/mol |
| IUPAC name | (1S,2R,6S,7R)-tricyclo[5.2.1.02,6]decane |
| InChIKey | LPSXSORODABQKT-FIRGSJFUSA-N |
| SMILES | C1C[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2C1 |
Computed by PubChem (NCBI)