cas: 1417789-76-4 — see every product listed under this CAS number, including other names
(3aR,6aR)-1-methyl-hexahydropyrrolo[3,4-b]pyrrole DiHCl, 97%, 97% (CAS 1417789-76-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112H3E-100mg |
| cas | 1417789-76-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1859.60 Pln | |
| Chemat | 250mg | 2464.40 Pln | |
| Chemat | 500mg | 4072.40 Pln | |
| Chemat | 1g | 6083.60 Pln | |
| Chemat | 5g | 18126.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3aR,6aR)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride (CAS 1417789-76-4) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3aR,6aR)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride. InChIKey: RUMPYDQZJSJKTJ-VJBFUYBPSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3aR,6aR)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
| InChIKey | RUMPYDQZJSJKTJ-VJBFUYBPSA-N |
| SMILES | CN1CC[C@H]2[C@@H]1CNC2.Cl.Cl |
Computed by PubChem (NCBI)