cas: 84110-34-9 — see every product listed under this CAS number, including other names
(3aS,4S,6S,7aR)-2-Isobutyl-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole, 95%, 95% (CAS 84110-34-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PM8-250mg |
| cas | 84110-34-9 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 774.80 Pln | |
| Chemat | 100g | 1451.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1S,2S,6R,8S)-2,9,9-trimethyl-4-(2-methylpropyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (CAS 84110-34-9) is a chemical compound with the molecular formula C14H25BO2 and a molecular weight of 236.16 g/mol. IUPAC name: (1S,2S,6R,8S)-2,9,9-trimethyl-4-(2-methylpropyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane. InChIKey: QGWQMLAZUPRXGK-FMSGJZPZSA-N.
| Molecular formula | C14H25BO2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | (1S,2S,6R,8S)-2,9,9-trimethyl-4-(2-methylpropyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| InChIKey | QGWQMLAZUPRXGK-FMSGJZPZSA-N |
| SMILES | B1(O[C@@H]2C[C@@H]3C[C@H]([C@@]2(O1)C)C3(C)C)CC(C)C |
Computed by PubChem (NCBI)