cas: 370880-16-3 — see every product listed under this CAS number, including other names
(3aS,6aS)-tert-Butyl hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate 98% (CAS 370880-16-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237746-50mg |
| cas | 370880-16-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 509.44 Pln | |
| Ambeed | 100mg | 648.50 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 3157.19 Pln | |
| Ambeed | 5g | 9259.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A237746 |
Tert-butyl (3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxylate (CAS 370880-16-3) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxylate. InChIKey: OIKZNKIPPFFTKA-DTWKUNHWSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxylate |
| InChIKey | OIKZNKIPPFFTKA-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1CNC2 |
Computed by PubChem (NCBI)