(4,4''-Di-tert-butyl-[1,1':3',1''-terphenyl]-2'-yl)boronic acid, 95%
cas: 2839120-21-5 — see every product listed under this CAS number, including other names
(4,4''-Di-tert-butyl-[1,1':3',1''-terphenyl]-2'-yl)boronic acid, 95% (CAS 2839120-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2983509-250mg |
| cas | 2839120-21-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 25g | 5554.62 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1758.29 Pln | |
| BLDpharm | 25g | 5979.03 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
[2,6-bis(4-tert-butylphenyl)phenyl]boronic acid (CAS 2839120-21-5) is a chemical compound with the molecular formula C26H31BO2 and a molecular weight of 386.3 g/mol. IUPAC name: [2,6-bis(4-tert-butylphenyl)phenyl]boronic acid. InChIKey: YKRMMQFIUKRJIS-UHFFFAOYSA-N.
| Molecular formula | C26H31BO2 |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | [2,6-bis(4-tert-butylphenyl)phenyl]boronic acid |
| InChIKey | YKRMMQFIUKRJIS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C2=CC=C(C=C2)C(C)(C)C)C3=CC=C(C=C3)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)