cas: 1224449-13-1 — see every product listed under this CAS number, including other names
(4-(((1-(tert-butoxycarbonyl)piperidin-4-yl)oxy)methyl)phenyl)boronic acid 95% (CAS 1224449-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273709-100mg |
| cas | 1224449-13-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1410.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A273709 |
[4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxymethyl]phenyl]boronic acid (CAS 1224449-13-1) is a chemical compound with the molecular formula C17H26BNO5 and a molecular weight of 335.2 g/mol. IUPAC name: [4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxymethyl]phenyl]boronic acid. InChIKey: QRAJJKKTWHWNET-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO5 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxymethyl]phenyl]boronic acid |
| InChIKey | QRAJJKKTWHWNET-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)