cas: 162356-89-0 — see every product listed under this CAS number, including other names
(4-(((Tert-butyldimethylsilyl)oxy)methyl)phenyl)boronic acid, 96% (CAS 162356-89-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696411-1G |
| cas | 162356-89-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 10g | 1861.86 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]boronic acid (CAS 162356-89-0) is a chemical compound with the molecular formula C13H23BO3Si and a molecular weight of 266.22 g/mol. IUPAC name: [4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]boronic acid. InChIKey: UMYBPELCCZPPOD-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3Si |
|---|---|
| Molecular weight | 266.22 g/mol |
| IUPAC name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]boronic acid |
| InChIKey | UMYBPELCCZPPOD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CO[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)