cas: 850568-22-8 — see every product listed under this CAS number, including other names
(4-((2-(Dimethylamino)ethyl)carbamoyl)phenyl)boronic acid hydrochloride 98% (CAS 850568-22-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A401900-5g |
| cas | 850568-22-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 10g | 1371.62 Pln | |
| Ambeed | 25g | 2656.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A401900 |
[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid;hydrochloride (CAS 850568-22-8) is a chemical compound with the molecular formula C11H18BClN2O3 and a molecular weight of 272.54 g/mol. IUPAC name: [4-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid;hydrochloride. InChIKey: UJXAREBBWZJMPR-UHFFFAOYSA-N.
| Molecular formula | C11H18BClN2O3 |
|---|---|
| Molecular weight | 272.54 g/mol |
| IUPAC name | [4-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid;hydrochloride |
| InChIKey | UJXAREBBWZJMPR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCN(C)C)(O)O.Cl |
Computed by PubChem (NCBI)