cas: 2377608-26-7 — see every product listed under this CAS number, including other names
(4-((tert-Butyldimethylsilyl)oxy)-3-chloro-2-fluorophenyl)boronic acid, 98% (CAS 2377608-26-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1518262-5g |
| cas | 2377608-26-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7855.96 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-fluorophenyl]boronic acid (CAS 2377608-26-7) is a chemical compound with the molecular formula C12H19BClFO3Si and a molecular weight of 304.63 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-fluorophenyl]boronic acid. InChIKey: XNAVSQMUJDLNSD-UHFFFAOYSA-N.
| Molecular formula | C12H19BClFO3Si |
|---|---|
| Molecular weight | 304.63 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-fluorophenyl]boronic acid |
| InChIKey | XNAVSQMUJDLNSD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)O[Si](C)(C)C(C)(C)C)Cl)F)(O)O |
Computed by PubChem (NCBI)