cas: 1678539-52-0 — see every product listed under this CAS number, including other names
(4-(1-(Ethoxycarbonyl)cyclopropyl)phenyl)boronic acid 97% (CAS 1678539-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A728996-250mg |
| cas | 1678539-52-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4219.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A728996 |
[4-(1-ethoxycarbonylcyclopropyl)phenyl]boronic acid (CAS 1678539-52-0) is a chemical compound with the molecular formula C12H15BO4 and a molecular weight of 234.06 g/mol. IUPAC name: [4-(1-ethoxycarbonylcyclopropyl)phenyl]boronic acid. InChIKey: IGXGGWGUOKCYGS-UHFFFAOYSA-N.
| Molecular formula | C12H15BO4 |
|---|---|
| Molecular weight | 234.06 g/mol |
| IUPAC name | [4-(1-ethoxycarbonylcyclopropyl)phenyl]boronic acid |
| InChIKey | IGXGGWGUOKCYGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC2)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)