(4-(2-(2-Methoxyethoxy)ethoxy)phenyl)boronic acid, 97%
cas: 1333122-38-5 — see every product listed under this CAS number, including other names
(4-(2-(2-Methoxyethoxy)ethoxy)phenyl)boronic acid, 97% (CAS 1333122-38-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1532782-250mg |
| cas | 1333122-38-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 2823.44 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 837.20 Pln | |
| Chemat | 5g | 2776.40 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 897.49 Pln | |
| BLDpharm | 5g | 3035.62 Pln | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 638.33 Pln | |
| Fluorochem | 1g | 1554.68 Pln | |
| Fluorochem | 5g | 5141.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-[2-(2-methoxyethoxy)ethoxy]phenyl]boronic acid (CAS 1333122-38-5) is a chemical compound with the molecular formula C11H17BO5 and a molecular weight of 240.06 g/mol. IUPAC name: [4-[2-(2-methoxyethoxy)ethoxy]phenyl]boronic acid. InChIKey: NCYODRIJBYEQMD-UHFFFAOYSA-N.
| Molecular formula | C11H17BO5 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | [4-[2-(2-methoxyethoxy)ethoxy]phenyl]boronic acid |
| InChIKey | NCYODRIJBYEQMD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCOCCOC)(O)O |
Computed by PubChem (NCBI)