cas: 943109-41-9 — see every product listed under this CAS number, including other names
(4-(3-Fluorophenyl)tetrahydro-2H-pyran-4-yl)methanamine (CAS 943109-41-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116Z8U-250mg |
| cas | 943109-41-9 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 1797.20 Pln |
| delivery time | 3 weeks |
|---|
[4-(3-fluorophenyl)oxan-4-yl]methanamine (CAS 943109-41-9) is a chemical compound with the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. IUPAC name: [4-(3-fluorophenyl)oxan-4-yl]methanamine. InChIKey: SZTJIHCPVBNZCD-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | [4-(3-fluorophenyl)oxan-4-yl]methanamine |
| InChIKey | SZTJIHCPVBNZCD-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CN)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)