cas: 54589-41-2 — see every product listed under this CAS number, including other names
(4-(Benzyloxy)phenyl)(phenyl)methanone (CAS 54589-41-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720701-1G |
| cas | 54589-41-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 25g | 1190.22 Pln | |
| Fluorochem | 100g | 3475.88 Pln |
| delivery time | 3-4 weeks |
|---|
Phenyl-(4-phenylmethoxyphenyl)methanone (CAS 54589-41-2) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: phenyl-(4-phenylmethoxyphenyl)methanone. InChIKey: NMPNTBQOLRXPGK-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | phenyl-(4-phenylmethoxyphenyl)methanone |
| InChIKey | NMPNTBQOLRXPGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)