(4-(Decyloxy)phenyl)(phenyl)methanone, 98+%
cas: 78392-97-9 — see every product listed under this CAS number, including other names
(4-(Decyloxy)phenyl)(phenyl)methanone, 98+% (CAS 78392-97-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1476676-25g |
| cas | 78392-97-9 |
| size | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 131.19 Pln | |
| Ambeed | 100g | 203.50 Pln | |
| Ambeed | 500g | 598.44 Pln | |
| BLDpharm | 25g | 136.64 Pln | |
| BLDpharm | 100g | 192.18 Pln | |
| BLDpharm | 500g | 586.48 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 155.60 Pln | |
| Chemat | 500g | 590.40 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 258.26 Pln | |
| Fluorochem | 500g | 950.72 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
(4-decoxyphenyl)-phenylmethanone (CAS 78392-97-9) is a chemical compound with the molecular formula C23H30O2 and a molecular weight of 338.5 g/mol. IUPAC name: (4-decoxyphenyl)-phenylmethanone. InChIKey: HQUPVZXXKOHWPK-UHFFFAOYSA-N.
| Molecular formula | C23H30O2 |
|---|---|
| Molecular weight | 338.5 g/mol |
| IUPAC name | (4-decoxyphenyl)-phenylmethanone |
| InChIKey | HQUPVZXXKOHWPK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)