(4-(Ethoxycarbonyl)phenyl)(mesityl)iodonium tetrafluoroborate, 97%
cas: 1416353-27-9 — see every product listed under this CAS number, including other names
(4-(Ethoxycarbonyl)phenyl)(mesityl)iodonium tetrafluoroborate, 97% (CAS 1416353-27-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1508788-250mg |
| cas | 1416353-27-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 848.75 Pln | |
| Ambeed | 10g | 1321.56 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 286.59 Pln | |
| BLDpharm | 5g | 836.40 Pln | |
| BLDpharm | 10g | 1291.79 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 942.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-ethoxycarbonylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate (CAS 1416353-27-9) is a chemical compound with the molecular formula C18H20BF4IO2 and a molecular weight of 482.1 g/mol. IUPAC name: (4-ethoxycarbonylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate. InChIKey: GSTSJFMVFUELLE-UHFFFAOYSA-N.
| Molecular formula | C18H20BF4IO2 |
|---|---|
| Molecular weight | 482.1 g/mol |
| IUPAC name | (4-ethoxycarbonylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate |
| InChIKey | GSTSJFMVFUELLE-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCOC(=O)C1=CC=C(C=C1)[I+]C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)