(4-(Ethoxycarbonyl)phenyl)(mesityl)iodonium trifluoromethanesulfonate, 97%
cas: 1204518-04-6 — see every product listed under this CAS number, including other names
(4-(Ethoxycarbonyl)phenyl)(mesityl)iodonium trifluoromethanesulfonate, 97% (CAS 1204518-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1497701-250mg |
| cas | 1204518-04-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 10g | 1249.25 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 281.04 Pln | |
| BLDpharm | 5g | 786.41 Pln | |
| BLDpharm | 10g | 1225.15 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 942.80 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1736.91 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-ethoxycarbonylphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate (CAS 1204518-04-6) is a chemical compound with the molecular formula C19H20F3IO5S and a molecular weight of 544.3 g/mol. IUPAC name: (4-ethoxycarbonylphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate. InChIKey: SQKODXFCGDTAKK-UHFFFAOYSA-M.
| Molecular formula | C19H20F3IO5S |
|---|---|
| Molecular weight | 544.3 g/mol |
| IUPAC name | (4-ethoxycarbonylphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate |
| InChIKey | SQKODXFCGDTAKK-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=C(C=C1)[I+]C2=C(C=C(C=C2C)C)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)