Products 2828439-69-4
CAS 2828439-69-4 is the registry number for (4-(Methoxycarbonyl)-1H-indol-6-yl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(4-methoxycarbonyl-1H-indol-6-yl)boronic acid (CAS 2828439-69-4) is a chemical compound with the molecular formula C10H10BNO4 and a molecular weight of 219.00 g/mol. IUPAC name: (4-methoxycarbonyl-1H-indol-6-yl)boronic acid. InChIKey: RCCWPFZOCPWTNB-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO4 |
|---|---|
| Molecular weight | 219.00 g/mol |
| IUPAC name | (4-methoxycarbonyl-1H-indol-6-yl)boronic acid |
| InChIKey | RCCWPFZOCPWTNB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C2C=CNC2=C1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)