(4-(Methylamino)-3-nitrophenyl)boronic acid, 95%
cas: 1313364-44-1 — see every product listed under this CAS number, including other names
(4-(Methylamino)-3-nitrophenyl)boronic acid, 95% (CAS 1313364-44-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1617989-250mg |
| cas | 1313364-44-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3663.37 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3683.60 Pln | |
| BLDpharm | 250mg | 486.52 Pln | |
| BLDpharm | 1g | 1169.61 Pln | |
| BLDpharm | 5g | 3946.41 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[4-(methylamino)-3-nitrophenyl]boronic acid (CAS 1313364-44-1) is a chemical compound with the molecular formula C7H9BN2O4 and a molecular weight of 195.97 g/mol. IUPAC name: [4-(methylamino)-3-nitrophenyl]boronic acid. InChIKey: WALSPGACNYWUKC-UHFFFAOYSA-N.
| Molecular formula | C7H9BN2O4 |
|---|---|
| Molecular weight | 195.97 g/mol |
| IUPAC name | [4-(methylamino)-3-nitrophenyl]boronic acid |
| InChIKey | WALSPGACNYWUKC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)