CAS 121239-75-6 appears in our catalog under these names: (4–(Octyloxy)phenyl)(phenyl)iodonium hexafluorostibate(V), [4-(Octyloxy)phenyl](phenyl)iodonium Hexafluoroantimonate, >98.0%(HPLC)(qNMR), p-(Octyloxyphenyl)phenyliodonium hexafluor antimonate, (4-(Octyloxy)phenyl)(phenyl)iodonium hexafluorostibate(V), 97%. Offered by: GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 500g.
Hexafluoroantimony(1-);(4-octoxyphenyl)-phenyliodanium (CAS 121239-75-6) is a chemical compound with the molecular formula C20H26F6IOSb and a molecular weight of 645.1 g/mol. IUPAC name: hexafluoroantimony(1-);(4-octoxyphenyl)-phenyliodanium. InChIKey: QBOTYWKRKSTVOV-UHFFFAOYSA-H.
| Molecular formula | C20H26F6IOSb |
|---|---|
| Molecular weight | 645.1 g/mol |
| IUPAC name | hexafluoroantimony(1-);(4-octoxyphenyl)-phenyliodanium |
| InChIKey | QBOTYWKRKSTVOV-UHFFFAOYSA-H |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)[I+]C2=CC=CC=C2.F[Sb-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)