cas: 2096339-82-9 — see every product listed under this CAS number, including other names
(4-(Piperidin-1-ylsulfonyl)-2-(trifluoromethyl)phenyl)boronic acid 97% (CAS 2096339-82-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193585-100mg |
| cas | 2096339-82-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 487.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193585 |
[4-piperidin-1-ylsulfonyl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2096339-82-9) is a chemical compound with the molecular formula C12H15BF3NO4S and a molecular weight of 337.13 g/mol. IUPAC name: [4-piperidin-1-ylsulfonyl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: NZVMEYITTREHFC-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO4S |
|---|---|
| Molecular weight | 337.13 g/mol |
| IUPAC name | [4-piperidin-1-ylsulfonyl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NZVMEYITTREHFC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)