cas: 486422-57-5 — see every product listed under this CAS number, including other names
(4-(Pyrrolidin-1-ylsulfonyl)phenyl)boronic acid (CAS 486422-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232221-250MG |
| cas | 486422-57-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 5g | 3168.69 Pln |
| delivery time | 3-4 weeks |
|---|
(4-pyrrolidin-1-ylsulfonylphenyl)boronic acid (CAS 486422-57-5) is a chemical compound with the molecular formula C10H14BNO4S and a molecular weight of 255.10 g/mol. IUPAC name: (4-pyrrolidin-1-ylsulfonylphenyl)boronic acid. InChIKey: LSQCNEYLDWKDHO-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4S |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | (4-pyrrolidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | LSQCNEYLDWKDHO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2CCCC2)(O)O |
Computed by PubChem (NCBI)