CAS 852475-03-7 appears in our catalog under these names: (4-(Triphenylsilyl)phenyl)boronic acid 95+%, (4-(Triphenylsilyl)phenyl)boronic acid, 95+%, 95+%, (4-(TRIPHENYLSILYL)PHENYL)BORONIC ACID, 95+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(4-triphenylsilylphenyl)boronic acid (CAS 852475-03-7) is a chemical compound with the molecular formula C24H21BO2Si and a molecular weight of 380.3 g/mol. IUPAC name: (4-triphenylsilylphenyl)boronic acid. InChIKey: PMOBXFBCSAQLOY-UHFFFAOYSA-N.
| Molecular formula | C24H21BO2Si |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | (4-triphenylsilylphenyl)boronic acid |
| InChIKey | PMOBXFBCSAQLOY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)