cas: 850589-33-2 — see every product listed under this CAS number, including other names
(4-(Thiazolidine-3-carbonyl)phenyl)boronic acid 98% (CAS 850589-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A347976-100mg |
| cas | 850589-33-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 3079.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A347976 |
[4-(1,3-thiazolidine-3-carbonyl)phenyl]boronic acid (CAS 850589-33-2) is a chemical compound with the molecular formula C10H12BNO3S and a molecular weight of 237.09 g/mol. IUPAC name: [4-(1,3-thiazolidine-3-carbonyl)phenyl]boronic acid. InChIKey: RMOBLFQUVHBXKX-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3S |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | [4-(1,3-thiazolidine-3-carbonyl)phenyl]boronic acid |
| InChIKey | RMOBLFQUVHBXKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N2CCSC2)(O)O |
Computed by PubChem (NCBI)