cas: 515162-20-6 — see every product listed under this CAS number, including other names
(4-[(4-Methylpiperazin-1-yl)methyl]phenyl)methylamine, 97% (CAS 515162-20-6) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635897-500MG |
| cas | 515162-20-6 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 883.04 Pln | |
| Fluorochem | 1g | 1247.50 Pln | |
| Fluorochem | 5g | 3600.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine (CAS 515162-20-6) is a chemical compound with the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. IUPAC name: [4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine. InChIKey: HILINUGDTTXRNZ-UHFFFAOYSA-N.
| Molecular formula | C13H21N3 |
|---|---|
| Molecular weight | 219.33 g/mol |
| IUPAC name | [4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine |
| InChIKey | HILINUGDTTXRNZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)