CAS 165114-85-2 is the registry number for (4-Amino-3-chlorophenyl)pentafluorosulfur, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-4-(pentafluoro-lambda6-sulfanyl)aniline (CAS 165114-85-2) is a chemical compound with the molecular formula C6H5ClF5NS and a molecular weight of 253.62 g/mol. IUPAC name: 2-chloro-4-(pentafluoro-lambda6-sulfanyl)aniline. InChIKey: GJOCFJZDJRKCHS-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF5NS |
|---|---|
| Molecular weight | 253.62 g/mol |
| IUPAC name | 2-chloro-4-(pentafluoro-lambda6-sulfanyl)aniline |
| InChIKey | GJOCFJZDJRKCHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(F)(F)(F)(F)F)Cl)N |
Computed by PubChem (NCBI)