cas: 1521197-86-3 — see every product listed under this CAS number, including other names
(4-Amino-3-ethoxyphenyl)(4-(4-methylpiperazin-1-yl)piperidin-1-yl)methanone, 98% (CAS 1521197-86-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1151370-25mg |
| cas | 1521197-86-3 |
| size | 25mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25mg | 974.89 Pln | |
| AmBeed | 50mg | 1202.74 Pln | |
| Fluorochem | 50mg | 799.74 Pln | |
| Fluorochem | 100mg | 1278.73 Pln | |
| Fluorochem | 250mg | 2476.23 Pln | |
| Fluorochem | 500mg | 4131.90 Pln | |
| Chemat | 100mg | 1701.20 Pln | |
| Chemat | 250mg | 2790.80 Pln | |
| Chemat | 1g | 5522.00 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-amino-3-ethoxyphenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone (CAS 1521197-86-3) is a chemical compound with the molecular formula C19H30N4O2 and a molecular weight of 346.5 g/mol. IUPAC name: (4-amino-3-ethoxyphenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone. InChIKey: UTLNLZLOPMMHMX-UHFFFAOYSA-N.
| Molecular formula | C19H30N4O2 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | (4-amino-3-ethoxyphenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone |
| InChIKey | UTLNLZLOPMMHMX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)N2CCC(CC2)N3CCN(CC3)C)N |
Computed by PubChem (NCBI)