cas: 50534-08-2 — see every product listed under this CAS number, including other names
(4-Aminophenyl)(4-(dimethylamino)piperidin-1-yl)methanone 95% (CAS 50534-08-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A723115-50mg |
| cas | 50534-08-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1099.06 Pln | |
| Ambeed | 250mg | 1816.62 Pln | |
| Ambeed | 1g | 4787.00 Pln | |
| Ambeed | 5g | 16590.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A723115 |
(4-aminophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone (CAS 50534-08-2) is a chemical compound with the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. IUPAC name: (4-aminophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone. InChIKey: ZZZGWXZXEDIVEW-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O |
|---|---|
| Molecular weight | 247.34 g/mol |
| IUPAC name | (4-aminophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone |
| InChIKey | ZZZGWXZXEDIVEW-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCN(CC1)C(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)