(4-Bromo-1-fluoronaphthalen-2-yl)boronic acid, 98%
cas: 913836-09-6 — see every product listed under this CAS number, including other names
(4-Bromo-1-fluoronaphthalen-2-yl)boronic acid, 98% (CAS 913836-09-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212486-250MG |
| cas | 913836-09-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1565.09 Pln | |
| Fluorochem | 10g | 3064.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-bromo-1-fluoronaphthalen-2-yl)boronic acid (CAS 913836-09-6) is a chemical compound with the molecular formula C10H7BBrFO2 and a molecular weight of 268.88 g/mol. IUPAC name: (4-bromo-1-fluoronaphthalen-2-yl)boronic acid. InChIKey: MIBHKCPNOCVGJI-UHFFFAOYSA-N.
| Molecular formula | C10H7BBrFO2 |
|---|---|
| Molecular weight | 268.88 g/mol |
| IUPAC name | (4-bromo-1-fluoronaphthalen-2-yl)boronic acid |
| InChIKey | MIBHKCPNOCVGJI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=CC=CC=C2C(=C1)Br)F)(O)O |
Computed by PubChem (NCBI)