CAS 1016231-40-5 appears in our catalog under these names: 4-BROMO-2,3,5,6-TETRAFLUOROPHENYLBORONIC ACID, 95%, 95%, (4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4-bromo-2,3,5,6-tetrafluorophenyl)boronic acid (CAS 1016231-40-5) is a chemical compound with the molecular formula C6H2BBrF4O2 and a molecular weight of 272.79 g/mol. IUPAC name: (4-bromo-2,3,5,6-tetrafluorophenyl)boronic acid. InChIKey: WFADCDXWIFNRJC-UHFFFAOYSA-N.
| Molecular formula | C6H2BBrF4O2 |
|---|---|
| Molecular weight | 272.79 g/mol |
| IUPAC name | (4-bromo-2,3,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | WFADCDXWIFNRJC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)Br)F)F)(O)O |
Computed by PubChem (NCBI)