cas: 860034-11-3 — see every product listed under this CAS number, including other names
(4-Bromo-2-nitrophenyl)boronic acid 95% (CAS 860034-11-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A413745-100mg |
| cas | 860034-11-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3980.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A413745 |
(4-bromo-2-nitrophenyl)boronic acid (CAS 860034-11-3) is a chemical compound with the molecular formula C6H5BBrNO4 and a molecular weight of 245.83 g/mol. IUPAC name: (4-bromo-2-nitrophenyl)boronic acid. InChIKey: QGDNYVAPNJFOMO-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrNO4 |
|---|---|
| Molecular weight | 245.83 g/mol |
| IUPAC name | (4-bromo-2-nitrophenyl)boronic acid |
| InChIKey | QGDNYVAPNJFOMO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)