cas: 96804-05-6 — see every product listed under this CAS number, including other names
(4-Bromophenyl)(2,2-diethoxyethyl)sulfane, 95% (CAS 96804-05-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F431142-100MG |
| cas | 96804-05-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 810.15 Pln | |
| Fluorochem | 250mg | 1325.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-4-(2,2-diethoxyethylsulfanyl)benzene (CAS 96804-05-6) is a chemical compound with the molecular formula C12H17BrO2S and a molecular weight of 305.23 g/mol. IUPAC name: 1-bromo-4-(2,2-diethoxyethylsulfanyl)benzene. InChIKey: PJKXVSLKUBXRSV-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO2S |
|---|---|
| Molecular weight | 305.23 g/mol |
| IUPAC name | 1-bromo-4-(2,2-diethoxyethylsulfanyl)benzene |
| InChIKey | PJKXVSLKUBXRSV-UHFFFAOYSA-N |
| SMILES | CCOC(CSC1=CC=C(C=C1)Br)OCC |
Computed by PubChem (NCBI)