cas: 7497-60-1 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)(4-nitrophenyl)methanone, 95%, 95% (CAS 7497-60-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119OF6-1g |
| cas | 7497-60-1 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 702.80 Pln | |
| Chemat | 10g | 1005.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-chlorophenyl)-(4-nitrophenyl)methanone (CAS 7497-60-1) is a chemical compound with the molecular formula C13H8ClNO3 and a molecular weight of 261.66 g/mol. IUPAC name: (4-chlorophenyl)-(4-nitrophenyl)methanone. InChIKey: CLFRUWPJQKSRRT-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO3 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-nitrophenyl)methanone |
| InChIKey | CLFRUWPJQKSRRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)