cas: 2364439-36-9 — see every product listed under this CAS number, including other names
(4-Cyano-3-hydroxyphenyl)boronic acid 98% (CAS 2364439-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A325710-100mg |
| cas | 2364439-36-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 1299.31 Pln | |
| Ambeed | 1g | 3474.25 Pln | |
| Ambeed | 5g | 6617.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A325710 |
(4-cyano-3-hydroxyphenyl)boronic acid (CAS 2364439-36-9) is a chemical compound with the molecular formula C7H6BNO3 and a molecular weight of 162.94 g/mol. IUPAC name: (4-cyano-3-hydroxyphenyl)boronic acid. InChIKey: KMXJMBDIDVFGQX-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO3 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | (4-cyano-3-hydroxyphenyl)boronic acid |
| InChIKey | KMXJMBDIDVFGQX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C#N)O)(O)O |
Computed by PubChem (NCBI)