CAS 20430-33-5 appears in our catalog under these names: (4-Cyanobenzyl)triphenylphosphonium chloride, 95%, (4-Cyanobenzyl)triphenylphosphonium chloride, 95+%, (4-Cyanobenzyl)triphenylphosphonium chloride, 99% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 5g.
(4-cyanophenyl)methyl-triphenylphosphanium chloride (CAS 20430-33-5) is a chemical compound with the molecular formula C26H21ClNP and a molecular weight of 413.9 g/mol. IUPAC name: (4-cyanophenyl)methyl-triphenylphosphanium chloride. InChIKey: GXMFPJIKPZDNCS-UHFFFAOYSA-M.
| Molecular formula | C26H21ClNP |
|---|---|
| Molecular weight | 413.9 g/mol |
| IUPAC name | (4-cyanophenyl)methyl-triphenylphosphanium chloride |
| InChIKey | GXMFPJIKPZDNCS-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=C(C=C2)C#N)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)