cas: 2797139-97-8 — see every product listed under this CAS number, including other names
(4R)-3-cyclopropyl-4-ethyl-2-oxo-pyrrolidine-3-carbonitrile, 97% (CAS 2797139-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TJI-100mg |
| cas | 2797139-97-8 |
| size | 100mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 674.00 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 500mg | 1427.60 Pln | |
| Chemat | 1g | 2104.40 Pln | |
| Chemat | 5g | 6218.00 Pln | |
| Fluorochem | 100mg | 1242.29 Pln | |
| Fluorochem | 250mg | 1637.98 Pln | |
| Fluorochem | 500mg | 2653.25 Pln | |
| Fluorochem | 1g | 3892.40 Pln | |
| Fluorochem | 5g | 11337.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4R)-3-cyclopropyl-4-ethyl-2-oxopyrrolidine-3-carbonitrile (CAS 2797139-97-8) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: (4R)-3-cyclopropyl-4-ethyl-2-oxopyrrolidine-3-carbonitrile. InChIKey: OMZIYSJCNGPYBY-BYDSUWOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (4R)-3-cyclopropyl-4-ethyl-2-oxopyrrolidine-3-carbonitrile |
| InChIKey | OMZIYSJCNGPYBY-BYDSUWOYSA-N |
| SMILES | CC[C@H]1CNC(=O)C1(C#N)C2CC2 |
Computed by PubChem (NCBI)