Products 2755167-59-8
CAS 2755167-59-8 appears in our catalog under these names: (4R,4'R)-4,4'-Dimethyl-4,4',5,5'-tetrahydro-2,2'-bioxazole, 97%, 97%, (R,R)-Me-Bisbox, 97%, (4R,4'R)-4,4'-Dimethyl-4,4',5,5'-tetrahydro-2,2'-bioxazole, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(4R)-4-methyl-2-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole (CAS 2755167-59-8) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: (4R)-4-methyl-2-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole. InChIKey: LPLHQOJOWVSLQY-PHDIDXHHSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (4R)-4-methyl-2-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole |
| InChIKey | LPLHQOJOWVSLQY-PHDIDXHHSA-N |
| SMILES | C[C@@H]1COC(=N1)C2=N[C@@H](CO2)C |
Computed by PubChem (NCBI)