(4S,4'S)-4,4'-Di(heptan-4-yl)-4,4',5,5'-tetrahydro-2,2'-bioxazole, 97%
cas: 2094476-37-4 — see every product listed under this CAS number, including other names
(4S,4'S)-4,4'-Di(heptan-4-yl)-4,4',5,5'-tetrahydro-2,2'-bioxazole, 97% (CAS 2094476-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1263809-100mg |
| cas | 2094476-37-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 954.44 Pln | |
| Ambeed | 250mg | 1716.50 Pln | |
| Ambeed | 1g | 3824.69 Pln | |
| Ambeed | 5g | 18832.31 Pln | |
| Ambeed | 10g | 30096.37 Pln | |
| BLDpharm | 100mg | 1025.22 Pln | |
| BLDpharm | 250mg | 1847.15 Pln | |
| BLDpharm | 1g | 4118.57 Pln | |
| BLDpharm | 5g | 18463.52 Pln | |
| BLDpharm | 10g | 29504.08 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-heptan-4-yl-2-[(4S)-4-heptan-4-yl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole (CAS 2094476-37-4) is a chemical compound with the molecular formula C20H36N2O2 and a molecular weight of 336.5 g/mol. IUPAC name: (4S)-4-heptan-4-yl-2-[(4S)-4-heptan-4-yl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole. InChIKey: JCIONGJTAFCVIQ-QZTJIDSGSA-N.
| Molecular formula | C20H36N2O2 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | (4S)-4-heptan-4-yl-2-[(4S)-4-heptan-4-yl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole |
| InChIKey | JCIONGJTAFCVIQ-QZTJIDSGSA-N |
| SMILES | CCCC(CCC)[C@H]1COC(=N1)C2=N[C@H](CO2)C(CCC)CCC |
Computed by PubChem (NCBI)
Synonyms:
(4S,4'S)-4,4'-Di(heptan-4-yl)-4,4',5,5'-tetrahydro-2,2'-bioxazole, (4S,4'S)-4,4',5,5'-Tetrahydro-4,4'-bis(1-propylbutyl)-2,2'-bioxazole, 2,2'-Bioxazole, 4,4',5,5'-tetrahydro-4,4'-bis(1-propylbutyl)-, (4S,4'S)-, (4S,4 S)-4,4 ,5,5 -Tetrahydro-4,4 -bis(1-propylbutyl)-2,2 -bioxazole, (4S,4?S)-4,4?,5,5?-Tetrahydro-4,4?-bis(1-propylbutyl)-2,2?-bioxazole, (4S,4'S)-4,4',5,5'-Tetrahydro-4,4'-bis(1-propylbutyl)-2,2'-bioxazole - [T89976]
