(4S,4'S,5R,5'R)-2,2'-(1-Phenylpropane-2,2-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole), 95%
cas: 2757082-38-3 — see every product listed under this CAS number, including other names
(4S,4'S,5R,5'R)-2,2'-(1-Phenylpropane-2,2-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole), 95% (CAS 2757082-38-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1258433-250mg |
| cas | 2757082-38-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1877.81 Pln | |
| Ambeed | 5g | 7807.44 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 775.31 Pln | |
| BLDpharm | 1g | 2019.31 Pln | |
| BLDpharm | 5g | 8411.51 Pln | |
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 1g | 2286.80 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 742.46 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4S,5R)-2-[2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole (CAS 2757082-38-3) is a chemical compound with the molecular formula C39H34N2O2 and a molecular weight of 562.7 g/mol. IUPAC name: (4S,5R)-2-[2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole. InChIKey: IGVIJCJVSBUFQB-CLLHQPRTSA-N.
| Molecular formula | C39H34N2O2 |
|---|---|
| Molecular weight | 562.7 g/mol |
| IUPAC name | (4S,5R)-2-[2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | IGVIJCJVSBUFQB-CLLHQPRTSA-N |
| SMILES | CC(CC1=CC=CC=C1)(C2=N[C@H]([C@H](O2)C3=CC=CC=C3)C4=CC=CC=C4)C5=N[C@H]([C@H](O5)C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)