(4S,4'S,5R,5'R)-2,2'-(2,3-Dihydro-1H-indene-2,2-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole), 97% 99%ee
cas: 2828432-09-1 — see every product listed under this CAS number, including other names
(4S,4'S,5R,5'R)-2,2'-(2,3-Dihydro-1H-indene-2,2-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole), 97% 99%ee (CAS 2828432-09-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1220211-250mg |
| cas | 2828432-09-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1215.88 Pln | |
| Ambeed | 1g | 2995.88 Pln | |
| Ambeed | 5g | 11762.38 Pln | |
| Chemat | 100mg | 717.20 Pln | |
| Chemat | 250mg | 1418.00 Pln | |
| Chemat | 1g | 3976.40 Pln | |
| BLDpharm | 100mg | 669.79 Pln | |
| BLDpharm | 250mg | 1308.45 Pln | |
| BLDpharm | 1g | 3224.44 Pln | |
| BLDpharm | 5g | 12682.23 Pln |
properties
| purity | 97% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
(4S,5R)-2-[2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole (CAS 2828432-09-1) is a chemical compound with the molecular formula C39H32N2O2 and a molecular weight of 560.7 g/mol. IUPAC name: (4S,5R)-2-[2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole. InChIKey: UYCBNAKEMVGOCN-CLLHQPRTSA-N.
| Molecular formula | C39H32N2O2 |
|---|---|
| Molecular weight | 560.7 g/mol |
| IUPAC name | (4S,5R)-2-[2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | UYCBNAKEMVGOCN-CLLHQPRTSA-N |
| SMILES | C1C2=CC=CC=C2CC1(C3=N[C@H]([C@H](O3)C4=CC=CC=C4)C5=CC=CC=C5)C6=N[C@H]([C@H](O6)C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)