cas: 1196703-48-6 — see every product listed under this CAS number, including other names
(4S,5R)-3-((S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-phenylpropanoyl)-2,2,5-trimethyloxazolidine-4-carboxylic acid, 98%, 98% (CAS 1196703-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119T5N-100mg |
| cas | 1196703-48-6 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S,5R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1196703-48-6) is a chemical compound with the molecular formula C31H32N2O6 and a molecular weight of 528.6 g/mol. IUPAC name: (4S,5R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: FFOYZGOZWLCJDO-VHEIIQRDSA-N.
| Molecular formula | C31H32N2O6 |
|---|---|
| Molecular weight | 528.6 g/mol |
| IUPAC name | (4S,5R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | FFOYZGOZWLCJDO-VHEIIQRDSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)[C@H](CC2=CC=CC=C2)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)