(4S,5R)-4,5-Diphenyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee
cas: 1997306-76-9 — see every product listed under this CAS number, including other names
(4S,5R)-4,5-Diphenyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee (CAS 1997306-76-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F693399-250MG |
| cas | 1997306-76-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 1g | 2622.01 Pln | |
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 2022.44 Pln | |
| Ambeed | 5g | 7879.75 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 2174.81 Pln | |
| BLDpharm | 5g | 8489.26 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1821.20 Pln |
properties
| purity | 97% 99%ee |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(4S,5R)-4,5-diphenyl-2-[5-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole (CAS 1997306-76-9) is a chemical compound with the molecular formula C21H15F3N2O and a molecular weight of 368.4 g/mol. IUPAC name: (4S,5R)-4,5-diphenyl-2-[5-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole. InChIKey: QFLUMJQUCAPCRJ-RBUKOAKNSA-N.
| Molecular formula | C21H15F3N2O |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (4S,5R)-4,5-diphenyl-2-[5-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | QFLUMJQUCAPCRJ-RBUKOAKNSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2[C@H](OC(=N2)C3=NC=C(C=C3)C(F)(F)F)C4=CC=CC=C4 |
Computed by PubChem (NCBI)