(4S,5S)-1,3-Bis(2,6-dimethoxyphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazol-3-ium tetrafluoroborate, 97%
cas: 1033618-47-1 — see every product listed under this CAS number, including other names
(4S,5S)-1,3-Bis(2,6-dimethoxyphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazol-3-ium tetrafluoroborate, 97% (CAS 1033618-47-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1517148-100mg |
| cas | 1033618-47-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1104.63 Pln | |
| Ambeed | 250mg | 1816.62 Pln | |
| Ambeed | 1g | 4620.12 Pln | |
| BLDpharm | 100mg | 1180.72 Pln | |
| BLDpharm | 250mg | 1952.67 Pln | |
| BLDpharm | 1g | 4979.38 Pln | |
| Chemat | 100mg | 842.00 Pln | |
| Chemat | 250mg | 1384.40 Pln | |
| Fluorochem | 100mg | 1559.89 Pln | |
| Fluorochem | 250mg | 2569.95 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,3-bis(2,6-dimethoxyphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate (CAS 1033618-47-1) is a chemical compound with the molecular formula C31H31BF4N2O4 and a molecular weight of 582.4 g/mol. IUPAC name: 1,3-bis(2,6-dimethoxyphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate. InChIKey: XNZNCRBIMWALRS-UHFFFAOYSA-N.
| Molecular formula | C31H31BF4N2O4 |
|---|---|
| Molecular weight | 582.4 g/mol |
| IUPAC name | 1,3-bis(2,6-dimethoxyphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
| InChIKey | XNZNCRBIMWALRS-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.COC1=C(C(=CC=C1)OC)N2C=[N+](C(C2C3=CC=CC=C3)C4=CC=CC=C4)C5=C(C=CC=C5OC)OC |
Computed by PubChem (NCBI)