(5-(Ethoxycarbonyl)furan-2-yl)boronic acid, 98%
cas: 1150114-44-5 — see every product listed under this CAS number, including other names
(5-(Ethoxycarbonyl)furan-2-yl)boronic acid, 98% (CAS 1150114-44-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A176996-100mg |
| cas | 1150114-44-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Ambeed | 25g | 4803.69 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 1097.42 Pln | |
| BLDpharm | 25g | 5179.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(5-ethoxycarbonylfuran-2-yl)boronic acid (CAS 1150114-44-5) is a chemical compound with the molecular formula C7H9BO5 and a molecular weight of 183.96 g/mol. IUPAC name: (5-ethoxycarbonylfuran-2-yl)boronic acid. InChIKey: USBGGMMAQCIWDL-UHFFFAOYSA-N.
| Molecular formula | C7H9BO5 |
|---|---|
| Molecular weight | 183.96 g/mol |
| IUPAC name | (5-ethoxycarbonylfuran-2-yl)boronic acid |
| InChIKey | USBGGMMAQCIWDL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)