cas: 1256346-41-4 — see every product listed under this CAS number, including other names
(5-Acetyl-4-bromothiophen-2-yl)boronic acid, 98% (CAS 1256346-41-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A849506-5g |
| cas | 1256346-41-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7855.96 Pln | |
| AmBeed | 10g | 15264.34 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(5-acetyl-4-bromothiophen-2-yl)boronic acid (CAS 1256346-41-4) is a chemical compound with the molecular formula C6H6BBrO3S and a molecular weight of 248.89 g/mol. IUPAC name: (5-acetyl-4-bromothiophen-2-yl)boronic acid. InChIKey: AVLZJKRBNRJJMY-UHFFFAOYSA-N.
| Molecular formula | C6H6BBrO3S |
|---|---|
| Molecular weight | 248.89 g/mol |
| IUPAC name | (5-acetyl-4-bromothiophen-2-yl)boronic acid |
| InChIKey | AVLZJKRBNRJJMY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(S1)C(=O)C)Br)(O)O |
Computed by PubChem (NCBI)